C27H42N2O5 — CID 17141336
decyl 2-[1-(4-butan-2-yloxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 17141336) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is decyl 2-[1-(4-butan-2-yloxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-(4-butan-2-yloxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17141336 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | decyl 2-[1-(4-butan-2-yloxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccc(OC(C)CC)cc1 |
| InChI | InChI=1S/C27H42N2O5/c1-4-6-7-8-9-10-11-12-19-33-25(30)20-24-26(31)28-17-18-29(24)27(32)22-13-15-23(16-14-22)34-21(3)5-2/h13-16,21,24H,4-12,17-20H2,1-3H3,(H,28,31) |
| InChIKey | WXZXSWXCERAPBH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|