C22H32N2O5 — CID 4933705
propan-2-yl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4933705) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is propan-2-yl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | propan-2-yl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4933705 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | propan-2-yl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C22H32N2O5/c1-4-5-6-7-14-28-18-10-8-17(9-11-18)22(27)24-13-12-23-21(26)19(24)15-20(25)29-16(2)3/h8-11,16,19H,4-7,12-15H2,1-3H3,(H,23,26) |
| InChIKey | ILULUWDHBVJZBP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|