C27H34N2O5 — CID 4933759
2-phenylethyl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4933759) has the molecular formula C27H34N2O5 and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4933759 |
| Molecular Formula | C27H34N2O5 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 2-phenylethyl 2-[1-(4-hexoxybenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCOc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H34N2O5/c1-2-3-4-8-18-33-23-13-11-22(12-14-23)27(32)29-17-16-28-26(31)24(29)20-25(30)34-19-15-21-9-6-5-7-10-21/h5-7,9-14,24H,2-4,8,15-20H2,1H3,(H,28,31) |
| InChIKey | TZHZHDXQZRSGIG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|