C27H42N2O6 — CID 17122807
decyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17122807) has the molecular formula C27H42N2O6 and a molecular weight of 490.64 g/mol. Its IUPAC name is decyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17122807 |
| Molecular Formula | C27H42N2O6 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | decyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccccc1OCCOCC |
| InChI | InChI=1S/C27H42N2O6/c1-3-5-6-7-8-9-10-13-18-35-25(30)21-23-26(31)28-16-17-29(23)27(32)22-14-11-12-15-24(22)34-20-19-33-4-2/h11-12,14-15,23H,3-10,13,16-21H2,1-2H3,(H,28,31) |
| InChIKey | OOVBSTKTDWITBC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|