C21H30N2O5 — CID 9232310
propyl 2-[(2R)-3-oxo-1-(2-pentoxybenzoyl)piperazin-2-yl]acetate (PubChem CID 9232310) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is propyl 2-[(2R)-3-oxo-1-(2-pentoxybenzoyl)piperazin-2-yl]acetate.
| Compound Name | propyl 2-[(2R)-3-oxo-1-(2-pentoxybenzoyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9232310 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | propyl 2-[(2R)-3-oxo-1-(2-pentoxybenzoyl)piperazin-2-yl]acetate |
| SMILES | CCCCCOc1ccccc1C(=O)N1CCNC(=O)[C@H]1CC(=O)OCCC |
| InChI | InChI=1S/C21H30N2O5/c1-3-5-8-14-27-18-10-7-6-9-16(18)21(26)23-12-11-22-20(25)17(23)15-19(24)28-13-4-2/h6-7,9-10,17H,3-5,8,11-15H2,1-2H3,(H,22,25)/t17-/m1/s1 |
| InChIKey | HJMCQWMSMZKFPG-QGZVFWFLSA-N |
| XLogP | 2.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|