C26H32N2O6 — CID 17122760
3-phenylpropyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17122760) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is 3-phenylpropyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 3-phenylpropyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17122760 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | 3-phenylpropyl 2-[1-[2-(2-ethoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOCCOc1ccccc1C(=O)N1CCNC(=O)C1CC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C26H32N2O6/c1-2-32-17-18-33-23-13-7-6-12-21(23)26(31)28-15-14-27-25(30)22(28)19-24(29)34-16-8-11-20-9-4-3-5-10-20/h3-7,9-10,12-13,22H,2,8,11,14-19H2,1H3,(H,27,30) |
| InChIKey | NPRSNICCBATPHN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|