C17H21N3O6 — CID 4959143
butyl 2-[1-(2-nitrobenzoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 4959143) has the molecular formula C17H21N3O6 and a molecular weight of 363.37 g/mol. Its IUPAC name is butyl 2-[1-(2-nitrobenzoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-(2-nitrobenzoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4959143 |
| Molecular Formula | C17H21N3O6 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | butyl 2-[1-(2-nitrobenzoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H21N3O6/c1-2-3-10-26-15(21)11-14-16(22)18-8-9-19(14)17(23)12-6-4-5-7-13(12)20(24)25/h4-7,14H,2-3,8-11H2,1H3,(H,18,22) |
| InChIKey | OTUZIOICTXAOHC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|