C16H18N4O6S — CID 4926837
ethyl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4926837) has the molecular formula C16H18N4O6S and a molecular weight of 394.41 g/mol. Its IUPAC name is ethyl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4926837 |
| Molecular Formula | C16H18N4O6S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H18N4O6S/c1-2-26-13(21)9-12-15(23)17-7-8-19(12)16(27)18-14(22)10-5-3-4-6-11(10)20(24)25/h3-6,12H,2,7-9H2,1H3,(H,17,23)(H,18,22,27) |
| InChIKey | RSCALEWCUCFBML-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|