C17H20N4O6S — CID 5030426
propan-2-yl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 5030426) has the molecular formula C17H20N4O6S and a molecular weight of 408.44 g/mol. Its IUPAC name is propan-2-yl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propan-2-yl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 5030426 |
| Molecular Formula | C17H20N4O6S |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | propan-2-yl 2-[1-[(2-nitrobenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)OC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N4O6S/c1-10(2)27-14(22)9-13-16(24)18-7-8-20(13)17(28)19-15(23)11-5-3-4-6-12(11)21(25)26/h3-6,10,13H,7-9H2,1-2H3,(H,18,24)(H,19,23,28) |
| InChIKey | AJSTUDWWJSZGIA-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|