C19H25N3O7 — CID 17096928
butan-2-yl 2-[1-[2-(2-nitrophenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17096928) has the molecular formula C19H25N3O7 and a molecular weight of 407.42 g/mol. Its IUPAC name is butan-2-yl 2-[1-[2-(2-nitrophenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-[2-(2-nitrophenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17096928 |
| Molecular Formula | C19H25N3O7 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | butan-2-yl 2-[1-[2-(2-nitrophenoxy)propanoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=O)C(C)Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H25N3O7/c1-4-12(2)28-17(23)11-15-18(24)20-9-10-21(15)19(25)13(3)29-16-8-6-5-7-14(16)22(26)27/h5-8,12-13,15H,4,9-11H2,1-3H3,(H,20,24) |
| InChIKey | YVYXHYWOQOAVJZ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|