C14H23ClN2O4 — CID 54792713
butan-2-yl 2-[1-(4-chlorobutanoyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 54792713) has the molecular formula C14H23ClN2O4 and a molecular weight of 318.80 g/mol. Its IUPAC name is butan-2-yl 2-[1-(4-chlorobutanoyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-(4-chlorobutanoyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54792713 |
| Molecular Formula | C14H23ClN2O4 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | butan-2-yl 2-[1-(4-chlorobutanoyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=O)CCCCl |
| InChI | InChI=1S/C14H23ClN2O4/c1-3-10(2)21-13(19)9-11-14(20)16-7-8-17(11)12(18)5-4-6-15/h10-11H,3-9H2,1-2H3,(H,16,20) |
| InChIKey | QKNGIZQBCQXZQO-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|