C25H38N2O5 — CID 54783904
butan-2-yl 2-[1-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54783904) has the molecular formula C25H38N2O5 and a molecular weight of 446.59 g/mol. Its IUPAC name is butan-2-yl 2-[1-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54783904 |
| Molecular Formula | C25H38N2O5 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | butan-2-yl 2-[1-[5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=O)C(C)(C)CCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C25H38N2O5/c1-7-19(4)32-22(28)16-20-23(29)26-12-13-27(20)24(30)25(5,6)11-8-14-31-21-15-17(2)9-10-18(21)3/h9-10,15,19-20H,7-8,11-14,16H2,1-6H3,(H,26,29) |
| InChIKey | SVRZBZLIRCPZLV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|