C20H27BrN2O5 — CID 17096888
butan-2-yl 2-[1-[2-(2-bromo-4-ethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17096888) has the molecular formula C20H27BrN2O5 and a molecular weight of 455.35 g/mol. Its IUPAC name is butan-2-yl 2-[1-[2-(2-bromo-4-ethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-[2-(2-bromo-4-ethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17096888 |
| Molecular Formula | C20H27BrN2O5 |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | butan-2-yl 2-[1-[2-(2-bromo-4-ethylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCc1ccc(OCC(=O)N2CCNC(=O)C2CC(=O)OC(C)CC)c(Br)c1 |
| InChI | InChI=1S/C20H27BrN2O5/c1-4-13(3)28-19(25)11-16-20(26)22-8-9-23(16)18(24)12-27-17-7-6-14(5-2)10-15(17)21/h6-7,10,13,16H,4-5,8-9,11-12H2,1-3H3,(H,22,26) |
| InChIKey | WVBQRDQXSSVABQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |