C21H29BrN2O5 — CID 17188961
butyl 2-[1-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17188961) has the molecular formula C21H29BrN2O5 and a molecular weight of 469.38 g/mol. Its IUPAC name is butyl 2-[1-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17188961 |
| Molecular Formula | C21H29BrN2O5 |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | butyl 2-[1-[2-(4-bromo-2-propan-2-ylphenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)COc1ccc(Br)cc1C(C)C |
| InChI | InChI=1S/C21H29BrN2O5/c1-4-5-10-28-20(26)12-17-21(27)23-8-9-24(17)19(25)13-29-18-7-6-15(22)11-16(18)14(2)3/h6-7,11,14,17H,4-5,8-10,12-13H2,1-3H3,(H,23,27) |
| InChIKey | YJOAHIDLTHWOGH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|