C19H23BrCl2N2O5 — CID 17095433
pentyl 2-[1-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17095433) has the molecular formula C19H23BrCl2N2O5 and a molecular weight of 510.21 g/mol. Its IUPAC name is pentyl 2-[1-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | pentyl 2-[1-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17095433 |
| Molecular Formula | C19H23BrCl2N2O5 |
| Molecular Weight | 510.21 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | pentyl 2-[1-[2-(2-bromo-4,6-dichlorophenoxy)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)CC1C(=O)NCCN1C(=O)COc1c(Cl)cc(Cl)cc1Br |
| InChI | InChI=1S/C19H23BrCl2N2O5/c1-2-3-4-7-28-17(26)10-15-19(27)23-5-6-24(15)16(25)11-29-18-13(20)8-12(21)9-14(18)22/h8-9,15H,2-7,10-11H2,1H3,(H,23,27) |
| InChIKey | WMCNWJQUYQFWOK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|