C10H15ClN2O4 — CID 18524131
ethyl 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 18524131) has the molecular formula C10H15ClN2O4 and a molecular weight of 262.69 g/mol. Its IUPAC name is ethyl 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | ethyl 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 18524131 |
| Molecular Formula | C10H15ClN2O4 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | ethyl 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=O)CCl |
| InChI | InChI=1S/C10H15ClN2O4/c1-2-17-9(15)5-7-10(16)12-3-4-13(7)8(14)6-11/h7H,2-6H2,1H3,(H,12,16) |
| InChIKey | RSLPGWDVPNKNMZ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|