C14H23N3O4 — CID 54794436
ethyl 2-[3-oxo-1-(piperidine-3-carbonyl)piperazin-2-yl]acetate (PubChem CID 54794436) has the molecular formula C14H23N3O4 and a molecular weight of 297.36 g/mol. Its IUPAC name is ethyl 2-[3-oxo-1-(piperidine-3-carbonyl)piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[3-oxo-1-(piperidine-3-carbonyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54794436 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | ethyl 2-[3-oxo-1-(piperidine-3-carbonyl)piperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=O)C1CCCNC1 |
| InChI | InChI=1S/C14H23N3O4/c1-2-21-12(18)8-11-13(19)16-6-7-17(11)14(20)10-4-3-5-15-9-10/h10-11,15H,2-9H2,1H3,(H,16,19) |
| InChIKey | IUIJQZBLQWFZRM-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |