C15H25N3O5 — CID 54794481
2-methoxyethyl 2-[3-oxo-1-(piperidine-4-carbonyl)piperazin-2-yl]acetate (PubChem CID 54794481) has the molecular formula C15H25N3O5 and a molecular weight of 327.38 g/mol. Its IUPAC name is 2-methoxyethyl 2-[3-oxo-1-(piperidine-4-carbonyl)piperazin-2-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[3-oxo-1-(piperidine-4-carbonyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54794481 |
| Molecular Formula | C15H25N3O5 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-methoxyethyl 2-[3-oxo-1-(piperidine-4-carbonyl)piperazin-2-yl]acetate |
| SMILES | COCCOC(=O)CC1C(=O)NCCN1C(=O)C1CCNCC1 |
| InChI | InChI=1S/C15H25N3O5/c1-22-8-9-23-13(19)10-12-14(20)17-6-7-18(12)15(21)11-2-4-16-5-3-11/h11-12,16H,2-10H2,1H3,(H,17,20) |
| InChIKey | XLWLSMFIHXKRCW-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|