C20H26N2O6 — CID 17133110
2-methoxyethyl 2-[1-[3-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17133110) has the molecular formula C20H26N2O6 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-methoxyethyl 2-[1-[3-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-methoxyethyl 2-[1-[3-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17133110 |
| Molecular Formula | C20H26N2O6 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-methoxyethyl 2-[1-[3-(2-methylprop-2-enoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | C=C(C)COc1cccc(C(=O)N2CCNC(=O)C2CC(=O)OCCOC)c1 |
| InChI | InChI=1S/C20H26N2O6/c1-14(2)13-28-16-6-4-5-15(11-16)20(25)22-8-7-21-19(24)17(22)12-18(23)27-10-9-26-3/h4-6,11,17H,1,7-10,12-13H2,2-3H3,(H,21,24) |
| InChIKey | WHZCNTNBRPBCCJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|