C24H27BrN2O7 — CID 17356407
2-phenoxyethyl 2-[1-[3-bromo-4-(2-methoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17356407) has the molecular formula C24H27BrN2O7 and a molecular weight of 535.39 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[1-[3-bromo-4-(2-methoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenoxyethyl 2-[1-[3-bromo-4-(2-methoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17356407 |
| Molecular Formula | C24H27BrN2O7 |
| Molecular Weight | 535.39 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 2-phenoxyethyl 2-[1-[3-bromo-4-(2-methoxyethoxy)benzoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COCCOc1ccc(C(=O)N2CCNC(=O)C2CC(=O)OCCOc2ccccc2)cc1Br |
| InChI | InChI=1S/C24H27BrN2O7/c1-31-11-12-33-21-8-7-17(15-19(21)25)24(30)27-10-9-26-23(29)20(27)16-22(28)34-14-13-32-18-5-3-2-4-6-18/h2-8,15,20H,9-14,16H2,1H3,(H,26,29) |
| InChIKey | BOZVGMFWKIOGPQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|