C20H34N2O6 — CID 17093824
4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobutanoic acid (PubChem CID 17093824) has the molecular formula C20H34N2O6 and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 17093824 |
| Molecular Formula | C20H34N2O6 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-[2-(2-decoxy-2-oxoethyl)-3-oxopiperazin-1-yl]-4-oxobutanoic acid |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C20H34N2O6/c1-2-3-4-5-6-7-8-9-14-28-19(26)15-16-20(27)21-12-13-22(16)17(23)10-11-18(24)25/h16H,2-15H2,1H3,(H,21,27)(H,24,25) |
| InChIKey | HDZRWWVCUXJJAJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|