C25H37ClN2O4 — CID 17179058
decyl 2-[1-[3-(2-chlorophenyl)propanoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17179058) has the molecular formula C25H37ClN2O4 and a molecular weight of 465.03 g/mol. Its IUPAC name is decyl 2-[1-[3-(2-chlorophenyl)propanoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[3-(2-chlorophenyl)propanoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17179058 |
| Molecular Formula | C25H37ClN2O4 |
| Molecular Weight | 465.03 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | decyl 2-[1-[3-(2-chlorophenyl)propanoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C25H37ClN2O4/c1-2-3-4-5-6-7-8-11-18-32-24(30)19-22-25(31)27-16-17-28(22)23(29)15-14-20-12-9-10-13-21(20)26/h9-10,12-13,22H,2-8,11,14-19H2,1H3,(H,27,31) |
| InChIKey | WOFSLWYEQRGPGC-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.03 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|