C24H33N3O6S — CID 4923395
3-phenylpropyl 5-oxo-5-[[3-oxo-2-(2-oxo-2-propan-2-yloxyethyl)piperazine-1-carbothioyl]amino]pentanoate (PubChem CID 4923395) has the molecular formula C24H33N3O6S and a molecular weight of 491.61 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[[3-oxo-2-(2-oxo-2-propan-2-yloxyethyl)piperazine-1-carbothioyl]amino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[[3-oxo-2-(2-oxo-2-propan-2-yloxyethyl)piperazine-1-carbothioyl]amino]pentanoate |
|---|---|
| PubChem CID | 4923395 |
| Molecular Formula | C24H33N3O6S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[[3-oxo-2-(2-oxo-2-propan-2-yloxyethyl)piperazine-1-carbothioyl]amino]pentanoate |
| SMILES | CC(C)OC(=O)CC1C(=O)NCCN1C(=S)NC(=O)CCCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C24H33N3O6S/c1-17(2)33-22(30)16-19-23(31)25-13-14-27(19)24(34)26-20(28)11-6-12-21(29)32-15-7-10-18-8-4-3-5-9-18/h3-5,8-9,17,19H,6-7,10-16H2,1-2H3,(H,25,31)(H,26,28,34) |
| InChIKey | KCNKHODTFMPUAH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|