C29H29N3O4S — CID 4947662
2-phenylethyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4947662) has the molecular formula C29H29N3O4S and a molecular weight of 515.64 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4947662 |
| Molecular Formula | C29H29N3O4S |
| Molecular Weight | 515.64 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | 2-phenylethyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=S)NC(=O)C(c1ccccc1)c1ccccc1)OCCc1ccccc1 |
| InChI | InChI=1S/C29H29N3O4S/c33-25(36-19-16-21-10-4-1-5-11-21)20-24-27(34)30-17-18-32(24)29(37)31-28(35)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-15,24,26H,16-20H2,(H,30,34)(H,31,35,37) |
| InChIKey | LTCKOQAIJSLUHU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.64 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|