C24H27N3O5S — CID 42426988
2-phenylethyl 2-[(2R)-1-[[2-(4-methoxyphenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 42426988) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is 2-phenylethyl 2-[(2R)-1-[[2-(4-methoxyphenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[(2R)-1-[[2-(4-methoxyphenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 42426988 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-phenylethyl 2-[(2R)-1-[[2-(4-methoxyphenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COc1ccc(CC(=O)NC(=S)N2CCNC(=O)[C@H]2CC(=O)OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H27N3O5S/c1-31-19-9-7-18(8-10-19)15-21(28)26-24(33)27-13-12-25-23(30)20(27)16-22(29)32-14-11-17-5-3-2-4-6-17/h2-10,20H,11-16H2,1H3,(H,25,30)(H,26,28,33)/t20-/m1/s1 |
| InChIKey | TZDRQUFMRMWYEF-HXUWFJFHSA-N |
| XLogP | 1.62 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|