C26H33N3O4S — CID 54787821
2-phenylethyl 2-[1-(adamantane-1-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 54787821) has the molecular formula C26H33N3O4S and a molecular weight of 483.63 g/mol. Its IUPAC name is 2-phenylethyl 2-[1-(adamantane-1-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenylethyl 2-[1-(adamantane-1-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54787821 |
| Molecular Formula | C26H33N3O4S |
| Molecular Weight | 483.63 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | 2-phenylethyl 2-[1-(adamantane-1-carbonylcarbamothioyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1C(=S)NC(=O)C12CC3CC(CC(C3)C1)C2)OCCc1ccccc1 |
| InChI | InChI=1S/C26H33N3O4S/c30-22(33-9-6-17-4-2-1-3-5-17)13-21-23(31)27-7-8-29(21)25(34)28-24(32)26-14-18-10-19(15-26)12-20(11-18)16-26/h1-5,18-21H,6-16H2,(H,27,31)(H,28,32,34) |
| InChIKey | JQHRGTUIXUXBNE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.63 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|