C21H25N3O6S — CID 6235086
ethyl (E)-4-oxo-4-[[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazine-1-carbothioyl]amino]but-2-enoate (PubChem CID 6235086) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is ethyl (E)-4-oxo-4-[[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazine-1-carbothioyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-4-oxo-4-[[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazine-1-carbothioyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 6235086 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | ethyl (E)-4-oxo-4-[[3-oxo-2-[2-oxo-2-(2-phenylethoxy)ethyl]piperazine-1-carbothioyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O6S/c1-2-29-18(26)9-8-17(25)23-21(31)24-12-11-22-20(28)16(24)14-19(27)30-13-10-15-6-4-3-5-7-15/h3-9,16H,2,10-14H2,1H3,(H,22,28)(H,23,25,31)/b9-8+ |
| InChIKey | MSXSEDSHZMODGG-CMDGGOBGSA-N |
| XLogP | 0.48 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|