C19H25N3O4S — CID 9298406
butyl 2-[(2R)-3-oxo-1-[(2-phenylacetyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 9298406) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is butyl 2-[(2R)-3-oxo-1-[(2-phenylacetyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | butyl 2-[(2R)-3-oxo-1-[(2-phenylacetyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 9298406 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | butyl 2-[(2R)-3-oxo-1-[(2-phenylacetyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)C[C@@H]1C(=O)NCCN1C(=S)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C19H25N3O4S/c1-2-3-11-26-17(24)13-15-18(25)20-9-10-22(15)19(27)21-16(23)12-14-7-5-4-6-8-14/h4-8,15H,2-3,9-13H2,1H3,(H,20,25)(H,21,23,27)/t15-/m1/s1 |
| InChIKey | BHUDUPSDCLLMPG-OAHLLOKOSA-N |
| XLogP | 1.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|