C31H41N3O4S — CID 17094107
decyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17094107) has the molecular formula C31H41N3O4S and a molecular weight of 551.75 g/mol. Its IUPAC name is decyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094107 |
| Molecular Formula | C31H41N3O4S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | decyl 2-[1-[(2,2-diphenylacetyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H41N3O4S/c1-2-3-4-5-6-7-8-15-22-38-27(35)23-26-29(36)32-20-21-34(26)31(39)33-30(37)28(24-16-11-9-12-17-24)25-18-13-10-14-19-25/h9-14,16-19,26,28H,2-8,15,20-23H2,1H3,(H,32,36)(H,33,37,39) |
| InChIKey | VXGVSXRAXLZOTA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|