C29H35N3O7S — CID 4923424
3-phenylpropyl 5-oxo-5-[[3-oxo-2-[2-oxo-2-(2-phenoxyethoxy)ethyl]piperazine-1-carbothioyl]amino]pentanoate (PubChem CID 4923424) has the molecular formula C29H35N3O7S and a molecular weight of 569.68 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[[3-oxo-2-[2-oxo-2-(2-phenoxyethoxy)ethyl]piperazine-1-carbothioyl]amino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[[3-oxo-2-[2-oxo-2-(2-phenoxyethoxy)ethyl]piperazine-1-carbothioyl]amino]pentanoate |
|---|---|
| PubChem CID | 4923424 |
| Molecular Formula | C29H35N3O7S |
| Molecular Weight | 569.68 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[[3-oxo-2-[2-oxo-2-(2-phenoxyethoxy)ethyl]piperazine-1-carbothioyl]amino]pentanoate |
| SMILES | O=C(CCCC(=O)OCCCc1ccccc1)NC(=S)N1CCNC(=O)C1CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C29H35N3O7S/c33-25(14-7-15-26(34)38-18-8-11-22-9-3-1-4-10-22)31-29(40)32-17-16-30-28(36)24(32)21-27(35)39-20-19-37-23-12-5-2-6-13-23/h1-6,9-10,12-13,24H,7-8,11,14-21H2,(H,30,36)(H,31,33,40) |
| InChIKey | AJVRBEGDHBVICD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|