C21H26N4O6S — CID 17176314
pentyl 2-[1-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17176314) has the molecular formula C21H26N4O6S and a molecular weight of 462.53 g/mol. Its IUPAC name is pentyl 2-[1-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | pentyl 2-[1-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17176314 |
| Molecular Formula | C21H26N4O6S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | pentyl 2-[1-[[(E)-3-(3-nitrophenyl)prop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H26N4O6S/c1-2-3-4-12-31-19(27)14-17-20(28)22-10-11-24(17)21(32)23-18(26)9-8-15-6-5-7-16(13-15)25(29)30/h5-9,13,17H,2-4,10-12,14H2,1H3,(H,22,28)(H,23,26,32)/b9-8+ |
| InChIKey | NVYJUTFYQMTELI-CMDGGOBGSA-N |
| XLogP | 1.93 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|