C20H24N4O7 — CID 4926296
propyl 2-[1-[2-acetamido-3-(3-nitrophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4926296) has the molecular formula C20H24N4O7 and a molecular weight of 432.43 g/mol. Its IUPAC name is propyl 2-[1-[2-acetamido-3-(3-nitrophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | propyl 2-[1-[2-acetamido-3-(3-nitrophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4926296 |
| Molecular Formula | C20H24N4O7 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | propyl 2-[1-[2-acetamido-3-(3-nitrophenyl)prop-2-enoyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCOC(=O)CC1C(=O)NCCN1C(=O)C(=Cc1cccc([N+](=O)[O-])c1)NC(C)=O |
| InChI | InChI=1S/C20H24N4O7/c1-3-9-31-18(26)12-17-19(27)21-7-8-23(17)20(28)16(22-13(2)25)11-14-5-4-6-15(10-14)24(29)30/h4-6,10-11,17H,3,7-9,12H2,1-2H3,(H,21,27)(H,22,25) |
| InChIKey | NRXSJDZUJYURCD-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|