C17H23N3O4S2 — CID 17073557
pentyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate (PubChem CID 17073557) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is pentyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate.
| Compound Name | pentyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17073557 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | pentyl 2-[3-oxo-1-(thiophene-2-carbonylcarbamothioyl)piperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-2-3-4-9-24-14(21)11-12-15(22)18-7-8-20(12)17(25)19-16(23)13-6-5-10-26-13/h5-6,10,12H,2-4,7-9,11H2,1H3,(H,18,22)(H,19,23,25) |
| InChIKey | UNAZHGZGCGNYFK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|