C22H31N3O5S — CID 17142769
pentyl 2-[3-oxo-1-[(3-propan-2-yloxybenzoyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 17142769) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is pentyl 2-[3-oxo-1-[(3-propan-2-yloxybenzoyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | pentyl 2-[3-oxo-1-[(3-propan-2-yloxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17142769 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | pentyl 2-[3-oxo-1-[(3-propan-2-yloxybenzoyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1cccc(OC(C)C)c1 |
| InChI | InChI=1S/C22H31N3O5S/c1-4-5-6-12-29-19(26)14-18-21(28)23-10-11-25(18)22(31)24-20(27)16-8-7-9-17(13-16)30-15(2)3/h7-9,13,15,18H,4-6,10-12,14H2,1-3H3,(H,23,28)(H,24,27,31) |
| InChIKey | TVRZSXLIOFNOSF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|