C18H23Cl2N3O4 — CID 54813251
butyl 2-[1-[2-(3,5-dichloroanilino)acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54813251) has the molecular formula C18H23Cl2N3O4 and a molecular weight of 416.31 g/mol. Its IUPAC name is butyl 2-[1-[2-(3,5-dichloroanilino)acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-(3,5-dichloroanilino)acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54813251 |
| Molecular Formula | C18H23Cl2N3O4 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | butyl 2-[1-[2-(3,5-dichloroanilino)acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2N3O4/c1-2-3-6-27-17(25)10-15-18(26)21-4-5-23(15)16(24)11-22-14-8-12(19)7-13(20)9-14/h7-9,15,22H,2-6,10-11H2,1H3,(H,21,26) |
| InChIKey | XENBBAKKTPKRIF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|