C21H30N4O5 — CID 54837924
butyl 2-[1-[2-[3-(ethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54837924) has the molecular formula C21H30N4O5 and a molecular weight of 418.49 g/mol. Its IUPAC name is butyl 2-[1-[2-[3-(ethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[3-(ethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54837924 |
| Molecular Formula | C21H30N4O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | butyl 2-[1-[2-[3-(ethylcarbamoyl)anilino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(C(=O)NCC)c1 |
| InChI | InChI=1S/C21H30N4O5/c1-3-5-11-30-19(27)13-17-21(29)23-9-10-25(17)18(26)14-24-16-8-6-7-15(12-16)20(28)22-4-2/h6-8,12,17,24H,3-5,9-11,13-14H2,1-2H3,(H,22,28)(H,23,29) |
| InChIKey | JMSUDLNIVMNBFS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|