C24H34N4O6 — CID 54837067
butyl 2-[3-oxo-1-[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]piperazin-2-yl]acetate (PubChem CID 54837067) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is butyl 2-[3-oxo-1-[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]piperazin-2-yl]acetate.
| Compound Name | butyl 2-[3-oxo-1-[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54837067 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | butyl 2-[3-oxo-1-[2-[3-(oxolan-2-ylmethylcarbamoyl)anilino]acetyl]piperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CNc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C24H34N4O6/c1-2-3-11-34-22(30)14-20-24(32)25-9-10-28(20)21(29)16-26-18-7-4-6-17(13-18)23(31)27-15-19-8-5-12-33-19/h4,6-7,13,19-20,26H,2-3,5,8-12,14-16H2,1H3,(H,25,32)(H,27,31) |
| InChIKey | BWMMAEVNFRLWTH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|