C20H29N3O4 — CID 54808784
butyl 2-[1-[2-[benzyl(methyl)amino]acetyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54808784) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is butyl 2-[1-[2-[benzyl(methyl)amino]acetyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butyl 2-[1-[2-[benzyl(methyl)amino]acetyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54808784 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | butyl 2-[1-[2-[benzyl(methyl)amino]acetyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCOC(=O)CC1C(=O)NCCN1C(=O)CN(C)Cc1ccccc1 |
| InChI | InChI=1S/C20H29N3O4/c1-3-4-12-27-19(25)13-17-20(26)21-10-11-23(17)18(24)15-22(2)14-16-8-6-5-7-9-16/h5-9,17H,3-4,10-15H2,1-2H3,(H,21,26) |
| InChIKey | SLWZMPHWHBLTKG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|