C20H35N3O3S — CID 43878504
decyl 2-[3-oxo-1-(prop-2-enylcarbamothioyl)piperazin-2-yl]acetate (PubChem CID 43878504) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is decyl 2-[3-oxo-1-(prop-2-enylcarbamothioyl)piperazin-2-yl]acetate.
| Compound Name | decyl 2-[3-oxo-1-(prop-2-enylcarbamothioyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 43878504 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | decyl 2-[3-oxo-1-(prop-2-enylcarbamothioyl)piperazin-2-yl]acetate |
| SMILES | C=CCNC(=S)N1CCNC(=O)C1CC(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C20H35N3O3S/c1-3-5-6-7-8-9-10-11-15-26-18(24)16-17-19(25)21-13-14-23(17)20(27)22-12-4-2/h4,17H,2-3,5-16H2,1H3,(H,21,25)(H,22,27) |
| InChIKey | QESDJTAZYBJAJP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|