C24H35N3O4S — CID 54782463
butan-2-yl 2-[1-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 54782463) has the molecular formula C24H35N3O4S and a molecular weight of 461.63 g/mol. Its IUPAC name is butan-2-yl 2-[1-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | butan-2-yl 2-[1-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54782463 |
| Molecular Formula | C24H35N3O4S |
| Molecular Weight | 461.63 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | butan-2-yl 2-[1-[2-[4-(2-methylpropyl)phenyl]propanoylcarbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCC(C)OC(=O)CC1C(=O)NCCN1C(=S)NC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O4S/c1-6-16(4)31-21(28)14-20-23(30)25-11-12-27(20)24(32)26-22(29)17(5)19-9-7-18(8-10-19)13-15(2)3/h7-10,15-17,20H,6,11-14H2,1-5H3,(H,25,30)(H,26,29,32) |
| InChIKey | WHIVCFHCHVUTSX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.63 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|