C20H26ClN3O4S — CID 17080007
3-methylbutyl 2-[1-[[2-(4-chlorophenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17080007) has the molecular formula C20H26ClN3O4S and a molecular weight of 439.97 g/mol. Its IUPAC name is 3-methylbutyl 2-[1-[[2-(4-chlorophenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[1-[[2-(4-chlorophenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17080007 |
| Molecular Formula | C20H26ClN3O4S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 3-methylbutyl 2-[1-[[2-(4-chlorophenyl)acetyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)CCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClN3O4S/c1-13(2)7-10-28-18(26)12-16-19(27)22-8-9-24(16)20(29)23-17(25)11-14-3-5-15(21)6-4-14/h3-6,13,16H,7-12H2,1-2H3,(H,22,27)(H,23,25,29) |
| InChIKey | JMCAEPXLJXPLOK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|