C20H26BrN3O5S — CID 17079973
3-methylbutyl 2-[1-[(3-bromo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17079973) has the molecular formula C20H26BrN3O5S and a molecular weight of 500.42 g/mol. Its IUPAC name is 3-methylbutyl 2-[1-[(3-bromo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 3-methylbutyl 2-[1-[(3-bromo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17079973 |
| Molecular Formula | C20H26BrN3O5S |
| Molecular Weight | 500.42 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | 3-methylbutyl 2-[1-[(3-bromo-4-methoxybenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | COc1ccc(C(=O)NC(=S)N2CCNC(=O)C2CC(=O)OCCC(C)C)cc1Br |
| InChI | InChI=1S/C20H26BrN3O5S/c1-12(2)6-9-29-17(25)11-15-19(27)22-7-8-24(15)20(30)23-18(26)13-4-5-16(28-3)14(21)10-13/h4-5,10,12,15H,6-9,11H2,1-3H3,(H,22,27)(H,23,26,30) |
| InChIKey | DAPYHAXKVILNOI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|