C19H24BrN3O5S — CID 4960884
2-ethoxyethyl 2-[1-[(3-bromo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 4960884) has the molecular formula C19H24BrN3O5S and a molecular weight of 486.39 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[1-[(3-bromo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-ethoxyethyl 2-[1-[(3-bromo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4960884 |
| Molecular Formula | C19H24BrN3O5S |
| Molecular Weight | 486.39 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-ethoxyethyl 2-[1-[(3-bromo-4-methylbenzoyl)carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCOCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C19H24BrN3O5S/c1-3-27-8-9-28-16(24)11-15-18(26)21-6-7-23(15)19(29)22-17(25)13-5-4-12(2)14(20)10-13/h4-5,10,15H,3,6-9,11H2,1-2H3,(H,21,26)(H,22,25,29) |
| InChIKey | PVLZHQOSFQXWCY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|