C22H23N3O4S — CID 4926836
ethyl 2-[3-oxo-1-[(4-phenylbenzoyl)carbamothioyl]piperazin-2-yl]acetate (PubChem CID 4926836) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is ethyl 2-[3-oxo-1-[(4-phenylbenzoyl)carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[3-oxo-1-[(4-phenylbenzoyl)carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 4926836 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | ethyl 2-[3-oxo-1-[(4-phenylbenzoyl)carbamothioyl]piperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-2-29-19(26)14-18-21(28)23-12-13-25(18)22(30)24-20(27)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,18H,2,12-14H2,1H3,(H,23,28)(H,24,27,30) |
| InChIKey | QUGFBKUHYQAKJC-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|