C21H21N3O4S2 — CID 6233073
benzyl 2-[3-oxo-1-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazin-2-yl]acetate (PubChem CID 6233073) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is benzyl 2-[3-oxo-1-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazin-2-yl]acetate.
| Compound Name | benzyl 2-[3-oxo-1-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 6233073 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | benzyl 2-[3-oxo-1-[[(E)-3-thiophen-2-ylprop-2-enoyl]carbamothioyl]piperazin-2-yl]acetate |
| SMILES | O=C(/C=C/c1cccs1)NC(=S)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21N3O4S2/c25-18(9-8-16-7-4-12-30-16)23-21(29)24-11-10-22-20(27)17(24)13-19(26)28-14-15-5-2-1-3-6-15/h1-9,12,17H,10-11,13-14H2,(H,22,27)(H,23,25,29)/b9-8+ |
| InChIKey | UTFSLSUBBWZGBN-CMDGGOBGSA-N |
| XLogP | 2.10 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|