C27H25N3O4S — CID 6233063
benzyl 2-[1-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 6233063) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is benzyl 2-[1-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[1-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 6233063 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | benzyl 2-[1-[[(E)-3-naphthalen-1-ylprop-2-enoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(/C=C/c1cccc2ccccc12)NC(=S)N1CCNC(=O)C1CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H25N3O4S/c31-24(14-13-21-11-6-10-20-9-4-5-12-22(20)21)29-27(35)30-16-15-28-26(33)23(30)17-25(32)34-18-19-7-2-1-3-8-19/h1-14,23H,15-18H2,(H,28,33)(H,29,31,35)/b14-13+ |
| InChIKey | CADMTPVLMCUSBJ-BUHFOSPRSA-N |
| XLogP | 3.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|