C27H32BrN3O6S — CID 17351093
2-phenoxyethyl 2-[1-[[5-bromo-2-(3-methylbutoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17351093) has the molecular formula C27H32BrN3O6S and a molecular weight of 606.54 g/mol. Its IUPAC name is 2-phenoxyethyl 2-[1-[[5-bromo-2-(3-methylbutoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | 2-phenoxyethyl 2-[1-[[5-bromo-2-(3-methylbutoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17351093 |
| Molecular Formula | C27H32BrN3O6S |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | 2-phenoxyethyl 2-[1-[[5-bromo-2-(3-methylbutoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)N1CCNC(=O)C1CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C27H32BrN3O6S/c1-18(2)10-13-36-23-9-8-19(28)16-21(23)25(33)30-27(38)31-12-11-29-26(34)22(31)17-24(32)37-15-14-35-20-6-4-3-5-7-20/h3-9,16,18,22H,10-15,17H2,1-2H3,(H,29,34)(H,30,33,38) |
| InChIKey | QMFYNMPWEHODCA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|