C27H40BrN3O6S — CID 17094191
decyl 2-[1-[[5-bromo-2-(2-methoxyethoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate (PubChem CID 17094191) has the molecular formula C27H40BrN3O6S and a molecular weight of 614.60 g/mol. Its IUPAC name is decyl 2-[1-[[5-bromo-2-(2-methoxyethoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate.
| Compound Name | decyl 2-[1-[[5-bromo-2-(2-methoxyethoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 17094191 |
| Molecular Formula | C27H40BrN3O6S |
| Molecular Weight | 614.60 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | decyl 2-[1-[[5-bromo-2-(2-methoxyethoxy)benzoyl]carbamothioyl]-3-oxopiperazin-2-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)CC1C(=O)NCCN1C(=S)NC(=O)c1cc(Br)ccc1OCCOC |
| InChI | InChI=1S/C27H40BrN3O6S/c1-3-4-5-6-7-8-9-10-15-37-24(32)19-22-26(34)29-13-14-31(22)27(38)30-25(33)21-18-20(28)11-12-23(21)36-17-16-35-2/h11-12,18,22H,3-10,13-17,19H2,1-2H3,(H,29,34)(H,30,33,38) |
| InChIKey | QTIDGVUSZJSMSN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|