C15H23FN4O — CID 105384991
[2-(ethylamino)-3-fluoro-4-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 105384991) has the molecular formula C15H23FN4O and a molecular weight of 294.37 g/mol. Its IUPAC name is [2-(ethylamino)-3-fluoro-4-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-(ethylamino)-3-fluoro-4-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 105384991 |
| Molecular Formula | C15H23FN4O |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [2-(ethylamino)-3-fluoro-4-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CCNc1nccc(C(=O)N2CCN(C(C)C)CC2)c1F |
| InChI | InChI=1S/C15H23FN4O/c1-4-17-14-13(16)12(5-6-18-14)15(21)20-9-7-19(8-10-20)11(2)3/h5-6,11H,4,7-10H2,1-3H3,(H,17,18) |
| InChIKey | HQGUYJGWULXSJT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |