C15H23BrN4O — CID 62168742
[5-bromo-2-(ethylamino)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 62168742) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is [5-bromo-2-(ethylamino)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-bromo-2-(ethylamino)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 62168742 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [5-bromo-2-(ethylamino)-3-pyridinyl]-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CCNc1ncc(Br)cc1C(=O)N1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C15H23BrN4O/c1-4-17-14-13(9-12(16)10-18-14)15(21)20-7-5-19(6-8-20)11(2)3/h9-11H,4-8H2,1-3H3,(H,17,18) |
| InChIKey | YGJGUZSYMSQZNA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |